C25H26N4OS — CID 139939399
4-[5-[[(11R,16S)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-14-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]benzonitrile (PubChem CID 139939399) has the molecular formula C25H26N4OS and a molecular weight of 430.58 g/mol. Its IUPAC name is 4-[5-[[(11R,16S)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-14-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]benzonitrile.
| Compound Name | 4-[5-[[(11R,16S)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-14-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 139939399 |
| Molecular Formula | C25H26N4OS |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-[5-[[(11R,16S)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-trien-14-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2=NOC(CN3CC[C@@H]4[C@H](C3)c3cccc5c3N4CCCS5)C2)cc1 |
| InChI | InChI=1S/C25H26N4OS/c26-14-17-5-7-18(8-6-17)22-13-19(30-27-22)15-28-11-9-23-21(16-28)20-3-1-4-24-25(20)29(23)10-2-12-31-24/h1,3-8,19,21,23H,2,9-13,15-16H2/t19?,21-,23-/m1/s1 |
| InChIKey | ZJHKRXGEWGSUBI-LNEVTVKDSA-N |
| XLogP | 4.23 |
| TPSA | 51.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |