C21H26N2O6 — CID 139939569
diethyl 1-ethyl-2,6-dimethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 139939569) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is diethyl 1-ethyl-2,6-dimethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-ethyl-2,6-dimethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139939569 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | diethyl 1-ethyl-2,6-dimethyl-4-(2-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(CC)C(C)=C(C(=O)OCC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N2O6/c1-6-22-13(4)17(20(24)28-7-2)19(18(14(22)5)21(25)29-8-3)15-11-9-10-12-16(15)23(26)27/h9-12,19H,6-8H2,1-5H3 |
| InChIKey | HYSYQOONGSVKTI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|