C27H21N3O9 — CID 139940652
1,2,3-tris[(2-nitrophenyl)methoxy]benzene (PubChem CID 139940652) has the molecular formula C27H21N3O9 and a molecular weight of 531.48 g/mol. Its IUPAC name is 1,2,3-tris[(2-nitrophenyl)methoxy]benzene.
| Compound Name | 1,2,3-tris[(2-nitrophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 139940652 |
| Molecular Formula | C27H21N3O9 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 1,2,3-tris[(2-nitrophenyl)methoxy]benzene |
| SMILES | O=[N+]([O-])c1ccccc1COc1cccc(OCc2ccccc2[N+](=O)[O-])c1OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21N3O9/c31-28(32)22-11-4-1-8-19(22)16-37-25-14-7-15-26(38-17-20-9-2-5-12-23(20)29(33)34)27(25)39-18-21-10-3-6-13-24(21)30(35)36/h1-15H,16-18H2 |
| InChIKey | VFRFPNARINATAZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 157.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|