C15H14O8S — CID 139940841
2-(4-sulfanylphenoxy)carbonylcyclopentane-1,1,2-tricarboxylic acid (PubChem CID 139940841) has the molecular formula C15H14O8S and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-(4-sulfanylphenoxy)carbonylcyclopentane-1,1,2-tricarboxylic acid.
| Compound Name | 2-(4-sulfanylphenoxy)carbonylcyclopentane-1,1,2-tricarboxylic acid |
|---|---|
| PubChem CID | 139940841 |
| Molecular Formula | C15H14O8S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-(4-sulfanylphenoxy)carbonylcyclopentane-1,1,2-tricarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCCC1(C(=O)O)C(=O)Oc1ccc(S)cc1 |
| InChI | InChI=1S/C15H14O8S/c16-10(17)14(11(18)19)6-1-7-15(14,12(20)21)13(22)23-8-2-4-9(24)5-3-8/h2-5,24H,1,6-7H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | BVAWOGDVAKJFBP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|