About 4-chloro-3-hydroxybutanenitrile;hydrate
4-chloro-3-hydroxybutanenitrile;hydrate (PubChem CID 139941560) has the molecular formula C4H8ClNO2
and a molecular weight of 137.57 g/mol. Its IUPAC name is 4-chloro-3-hydroxybutanenitrile;hydrate.
Molecular Properties
| Compound Name | 4-chloro-3-hydroxybutanenitrile;hydrate |
| PubChem CID | 139941560 |
| Molecular Formula | C4H8ClNO2 |
| Molecular Weight | 137.57 g/mol |
| Exact Mass | 137.02 |
| IUPAC Name | 4-chloro-3-hydroxybutanenitrile;hydrate |
| SMILES | N#CCC(O)CCl.O |
| InChI | InChI=1S/C4H6ClNO.H2O/c5-3-4(7)1-2-6;/h4,7H,1,3H2;1H2 |
| InChIKey | RCLBYBWSJITTJY-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.57 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-hydroxybutanenitrile;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-hydroxybutanenitrile;hydrate?
The IUPAC name of 4-chloro-3-hydroxybutanenitrile;hydrate (CID 139941560) is 4-chloro-3-hydroxybutanenitrile;hydrate.
What is the SMILES notation for 4-chloro-3-hydroxybutanenitrile;hydrate?
The canonical SMILES for 4-chloro-3-hydroxybutanenitrile;hydrate is N#CCC(O)CCl.O.
What is the InChIKey of 4-chloro-3-hydroxybutanenitrile;hydrate?
The InChIKey is RCLBYBWSJITTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClNO.H2O/c5-3-4(7)1-2-6;/h4,7H,1,3H2;1H2.
What are the key properties of 4-chloro-3-hydroxybutanenitrile;hydrate?
4-chloro-3-hydroxybutanenitrile;hydrate has a molecular weight of 137.57 g/mol, XLogP of -0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-hydroxybutanenitrile;hydrate is sourced from PubChem (CID 139941560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).