C17H26 — CID 139941681
1,4-dipropyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 139941681) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 1,4-dipropyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 1,4-dipropyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 139941681 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1,4-dipropyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | CCCc1ccc(CCC)c2c1CCCCC2 |
| InChI | InChI=1S/C17H26/c1-3-8-14-12-13-15(9-4-2)17-11-7-5-6-10-16(14)17/h12-13H,3-11H2,1-2H3 |
| InChIKey | MVVXEZZAVFBTBZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |