C30H30O3 — CID 139941740
1,2,4-tris[(3-methylphenyl)methoxy]benzene (PubChem CID 139941740) has the molecular formula C30H30O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1,2,4-tris[(3-methylphenyl)methoxy]benzene.
| Compound Name | 1,2,4-tris[(3-methylphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 139941740 |
| Molecular Formula | C30H30O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1,2,4-tris[(3-methylphenyl)methoxy]benzene |
| SMILES | Cc1cccc(COc2ccc(OCc3cccc(C)c3)c(OCc3cccc(C)c3)c2)c1 |
| InChI | InChI=1S/C30H30O3/c1-22-7-4-10-25(15-22)19-31-28-13-14-29(32-20-26-11-5-8-23(2)16-26)30(18-28)33-21-27-12-6-9-24(3)17-27/h4-18H,19-21H2,1-3H3 |
| InChIKey | FECHXKCWGSKUES-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |