C20H16Cl2O3 — CID 139941886
2,5-bis[(3-chlorophenyl)methoxy]phenol (PubChem CID 139941886) has the molecular formula C20H16Cl2O3 and a molecular weight of 375.25 g/mol. Its IUPAC name is 2,5-bis[(3-chlorophenyl)methoxy]phenol.
| Compound Name | 2,5-bis[(3-chlorophenyl)methoxy]phenol |
|---|---|
| PubChem CID | 139941886 |
| Molecular Formula | C20H16Cl2O3 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2,5-bis[(3-chlorophenyl)methoxy]phenol |
| SMILES | Oc1cc(OCc2cccc(Cl)c2)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2O3/c21-16-5-1-3-14(9-16)12-24-18-7-8-20(19(23)11-18)25-13-15-4-2-6-17(22)10-15/h1-11,23H,12-13H2 |
| InChIKey | OUNGYTPZPUTHIS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |