C29H51F6N3O2 — CID 139942202
2,2,2-trifluoro-N-[5-[3-[[(Z)-tetradec-5-enyl]amino]propyl]-8-[(2,2,2-trifluoroacetyl)amino]octyl]acetamide (PubChem CID 139942202) has the molecular formula C29H51F6N3O2 and a molecular weight of 587.73 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[5-[3-[[(Z)-tetradec-5-enyl]amino]propyl]-8-[(2,2,2-trifluoroacetyl)amino]octyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[5-[3-[[(Z)-tetradec-5-enyl]amino]propyl]-8-[(2,2,2-trifluoroacetyl)amino]octyl]acetamide |
|---|---|
| PubChem CID | 139942202 |
| Molecular Formula | C29H51F6N3O2 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.39 |
| IUPAC Name | 2,2,2-trifluoro-N-[5-[3-[[(Z)-tetradec-5-enyl]amino]propyl]-8-[(2,2,2-trifluoroacetyl)amino]octyl]acetamide |
| SMILES | CCCCCCCC/C=C\CCCCNCCCC(CCCCNC(=O)C(F)(F)F)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C29H51F6N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-14-21-36-22-16-19-25(20-17-24-38-27(40)29(33,34)35)18-13-15-23-37-26(39)28(30,31)32/h9-10,25,36H,2-8,11-24H2,1H3,(H,37,39)(H,38,40)/b10-9- |
| InChIKey | QWXCGPKWGGYZNP-KTKRTIGZSA-N |
| XLogP | 7.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|