C18H22N6O — CID 139942549
4-[[4-[2-(dimethylamino)ethyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-3-yl-1H-pyrazol-5-one (PubChem CID 139942549) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 4-[[4-[2-(dimethylamino)ethyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-3-yl-1H-pyrazol-5-one.
| Compound Name | 4-[[4-[2-(dimethylamino)ethyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-3-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 139942549 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 4-[[4-[2-(dimethylamino)ethyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-3-yl-1H-pyrazol-5-one |
| SMILES | Cc1[nH]c(C=C2C(=O)NN=C2c2cccnn2)c(C)c1CCN(C)C |
| InChI | InChI=1S/C18H22N6O/c1-11-13(7-9-24(3)4)12(2)20-16(11)10-14-17(22-23-18(14)25)15-6-5-8-19-21-15/h5-6,8,10,20H,7,9H2,1-4H3,(H,23,25) |
| InChIKey | AJFQVWLIIZRPCT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|