C30H26F3N5O3 — CID 139942883
methyl 3-[[4-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]phenyl]carbamoyl]-2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 139942883) has the molecular formula C30H26F3N5O3 and a molecular weight of 561.56 g/mol. Its IUPAC name is methyl 3-[[4-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]phenyl]carbamoyl]-2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | methyl 3-[[4-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]phenyl]carbamoyl]-2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 139942883 |
| Molecular Formula | C30H26F3N5O3 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | methyl 3-[[4-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]phenyl]carbamoyl]-2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2ccc(N3CCC(Nc4ncccn4)C3)cc2)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H26F3N5O3/c1-41-28(40)25-5-2-4-24(26(25)19-6-8-20(9-7-19)30(31,32)33)27(39)36-21-10-12-23(13-11-21)38-17-14-22(18-38)37-29-34-15-3-16-35-29/h2-13,15-16,22H,14,17-18H2,1H3,(H,36,39)(H,34,35,37) |
| InChIKey | KMNDYLHQIVQVRI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|