C16H27N3O2 — CID 139944538
2-methyl-N-[3,3,5,5-tetramethyl-4-(2-methylprop-2-enoyl)piperazin-1-yl]prop-2-enamide (PubChem CID 139944538) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-methyl-N-[3,3,5,5-tetramethyl-4-(2-methylprop-2-enoyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3,3,5,5-tetramethyl-4-(2-methylprop-2-enoyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139944538 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-methyl-N-[3,3,5,5-tetramethyl-4-(2-methylprop-2-enoyl)piperazin-1-yl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NN1CC(C)(C)N(C(=O)C(=C)C)C(C)(C)C1 |
| InChI | InChI=1S/C16H27N3O2/c1-11(2)13(20)17-18-9-15(5,6)19(14(21)12(3)4)16(7,8)10-18/h1,3,9-10H2,2,4-8H3,(H,17,20) |
| InChIKey | GLJGEZXDRXWWGU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|