About 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide
4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide (PubChem CID 139944583) has the molecular formula C9H18N4O2S
and a molecular weight of 246.34 g/mol. Its IUPAC name is 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide |
| PubChem CID | 139944583 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)n1cnc(CCCCN)c1 |
| InChI | InChI=1S/C9H18N4O2S/c1-12(2)16(14,15)13-7-9(11-8-13)5-3-4-6-10/h7-8H,3-6,10H2,1-2H3 |
| InChIKey | OZJKEXCUBHWJAE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide?
The IUPAC name of 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide (CID 139944583) is 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide.
What is the SMILES notation for 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide?
The canonical SMILES for 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide is CN(C)S(=O)(=O)n1cnc(CCCCN)c1.
What is the InChIKey of 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide?
The InChIKey is OZJKEXCUBHWJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O2S/c1-12(2)16(14,15)13-7-9(11-8-13)5-3-4-6-10/h7-8H,3-6,10H2,1-2H3.
What are the key properties of 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide?
4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide has a molecular weight of 246.34 g/mol, XLogP of -0.18, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminobutyl)-N,N-dimethylimidazole-1-sulfonamide is sourced from PubChem (CID 139944583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).