C19H16N4O2 — CID 139946229
2-(5-methoxy-1H-indol-3-yl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 139946229) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 139946229 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | COc1ccc2[nH]cc(-c3nc4cccc5c4n3CCNC5=O)c2c1 |
| InChI | InChI=1S/C19H16N4O2/c1-25-11-5-6-15-13(9-11)14(10-21-15)18-22-16-4-2-3-12-17(16)23(18)8-7-20-19(12)24/h2-6,9-10,21H,7-8H2,1H3,(H,20,24) |
| InChIKey | ABTPQYUIPFTBFQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |