C26H18Br2N2O4S2 — CID 139947697
N-[4,5-dibromo-2-(naphthalen-1-ylsulfonylamino)phenyl]naphthalene-1-sulfonamide (PubChem CID 139947697) has the molecular formula C26H18Br2N2O4S2 and a molecular weight of 646.38 g/mol. Its IUPAC name is N-[4,5-dibromo-2-(naphthalen-1-ylsulfonylamino)phenyl]naphthalene-1-sulfonamide.
| Compound Name | N-[4,5-dibromo-2-(naphthalen-1-ylsulfonylamino)phenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 139947697 |
| Molecular Formula | C26H18Br2N2O4S2 |
| Molecular Weight | 646.38 g/mol |
| Exact Mass | 643.91 |
| IUPAC Name | N-[4,5-dibromo-2-(naphthalen-1-ylsulfonylamino)phenyl]naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Br)c(Br)cc1NS(=O)(=O)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H18Br2N2O4S2/c27-21-15-23(29-35(31,32)25-13-5-9-17-7-1-3-11-19(17)25)24(16-22(21)28)30-36(33,34)26-14-6-10-18-8-2-4-12-20(18)26/h1-16,29-30H |
| InChIKey | DVVZWCTVGLYBKS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.38 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |