C11H25ClO4Si — CID 139948642
1-chloro-3-[3-[diethoxy(methyl)silyl]propoxy]propan-2-ol (PubChem CID 139948642) has the molecular formula C11H25ClO4Si and a molecular weight of 284.86 g/mol. Its IUPAC name is 1-chloro-3-[3-[diethoxy(methyl)silyl]propoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[3-[diethoxy(methyl)silyl]propoxy]propan-2-ol |
|---|---|
| PubChem CID | 139948642 |
| Molecular Formula | C11H25ClO4Si |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-chloro-3-[3-[diethoxy(methyl)silyl]propoxy]propan-2-ol |
| SMILES | CCO[Si](C)(CCCOCC(O)CCl)OCC |
| InChI | InChI=1S/C11H25ClO4Si/c1-4-15-17(3,16-5-2)8-6-7-14-10-11(13)9-12/h11,13H,4-10H2,1-3H3 |
| InChIKey | AXPCNDGQTASANO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|