C35H42F3N3O5 — CID 139949160
N-[[4-[4-[4-(2,6-dimethoxyphenyl)butanoylamino]butyl]morpholin-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 139949160) has the molecular formula C35H42F3N3O5 and a molecular weight of 641.73 g/mol. Its IUPAC name is N-[[4-[4-[4-(2,6-dimethoxyphenyl)butanoylamino]butyl]morpholin-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[[4-[4-[4-(2,6-dimethoxyphenyl)butanoylamino]butyl]morpholin-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139949160 |
| Molecular Formula | C35H42F3N3O5 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | N-[[4-[4-[4-(2,6-dimethoxyphenyl)butanoylamino]butyl]morpholin-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1cccc(OC)c1CCCC(=O)NCCCCN1CCOC(CNC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C35H42F3N3O5/c1-44-31-12-8-13-32(45-2)30(31)11-7-14-33(42)39-19-5-6-20-41-21-22-46-27(24-41)23-40-34(43)29-10-4-3-9-28(29)25-15-17-26(18-16-25)35(36,37)38/h3-4,8-10,12-13,15-18,27H,5-7,11,14,19-24H2,1-2H3,(H,39,42)(H,40,43) |
| InChIKey | HCQHLMQEPKISKM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|