About 1-methylcarbazol-1-ol
1-methylcarbazol-1-ol (PubChem CID 139949724) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-methylcarbazol-1-ol.
Molecular Properties
| Compound Name | 1-methylcarbazol-1-ol |
| PubChem CID | 139949724 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 1-methylcarbazol-1-ol |
| SMILES | CC1(O)C=CC=C2C1=Nc1ccccc12 |
| InChI | InChI=1S/C13H11NO/c1-13(15)8-4-6-10-9-5-2-3-7-11(9)14-12(10)13/h2-8,15H,1H3 |
| InChIKey | XSMXFJWNHRLLMG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylcarbazol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcarbazol-1-ol?
The IUPAC name of 1-methylcarbazol-1-ol (CID 139949724) is 1-methylcarbazol-1-ol.
What is the SMILES notation for 1-methylcarbazol-1-ol?
The canonical SMILES for 1-methylcarbazol-1-ol is CC1(O)C=CC=C2C1=Nc1ccccc12.
What is the InChIKey of 1-methylcarbazol-1-ol?
The InChIKey is XSMXFJWNHRLLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-13(15)8-4-6-10-9-5-2-3-7-11(9)14-12(10)13/h2-8,15H,1H3.
What are the key properties of 1-methylcarbazol-1-ol?
1-methylcarbazol-1-ol has a molecular weight of 197.24 g/mol, XLogP of 2.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcarbazol-1-ol is sourced from PubChem (CID 139949724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).