About benzyl-di(nonyl)azanium chloride
benzyl-di(nonyl)azanium chloride (PubChem CID 139949788) has the molecular formula C25H46ClN
and a molecular weight of 396.10 g/mol. Its IUPAC name is benzyl-di(nonyl)azanium chloride.
Molecular Properties
| Compound Name | benzyl-di(nonyl)azanium chloride |
| PubChem CID | 139949788 |
| Molecular Formula | C25H46ClN |
| Molecular Weight | 396.10 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | benzyl-di(nonyl)azanium chloride |
| SMILES | CCCCCCCCC[NH+](CCCCCCCCC)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C25H45N.ClH/c1-3-5-7-9-11-13-18-22-26(24-25-20-16-15-17-21-25)23-19-14-12-10-8-6-4-2;/h15-17,20-21H,3-14,18-19,22-24H2,1-2H3;1H |
| InChIKey | BVWUEALDSBTAPX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.10 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl-di(nonyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-di(nonyl)azanium chloride?
The IUPAC name of benzyl-di(nonyl)azanium chloride (CID 139949788) is benzyl-di(nonyl)azanium chloride.
What is the SMILES notation for benzyl-di(nonyl)azanium chloride?
The canonical SMILES for benzyl-di(nonyl)azanium chloride is CCCCCCCCC[NH+](CCCCCCCCC)Cc1ccccc1.[Cl-].
What is the InChIKey of benzyl-di(nonyl)azanium chloride?
The InChIKey is BVWUEALDSBTAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H45N.ClH/c1-3-5-7-9-11-13-18-22-26(24-25-20-16-15-17-21-25)23-19-14-12-10-8-6-4-2;/h15-17,20-21H,3-14,18-19,22-24H2,1-2H3;1H.
What are the key properties of benzyl-di(nonyl)azanium chloride?
benzyl-di(nonyl)azanium chloride has a molecular weight of 396.10 g/mol, XLogP of 3.58, 18 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-di(nonyl)azanium chloride is sourced from PubChem (CID 139949788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).