About dioxidoboranylformonitrile;bis(trimethylazanium)
dioxidoboranylformonitrile;bis(trimethylazanium) (PubChem CID 139949980) has the molecular formula C7H20BN3O2
and a molecular weight of 189.07 g/mol. Its IUPAC name is dioxidoboranylformonitrile;bis(trimethylazanium).
Molecular Properties
| Compound Name | dioxidoboranylformonitrile;bis(trimethylazanium) |
| PubChem CID | 139949980 |
| Molecular Formula | C7H20BN3O2 |
| Molecular Weight | 189.07 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | dioxidoboranylformonitrile;bis(trimethylazanium) |
| SMILES | C[NH+](C)C.C[NH+](C)C.N#CB([O-])[O-] |
| InChI | InChI=1S/2C3H9N.CBNO2/c2*1-4(2)3;3-1-2(4)5/h2*1-3H3;/q;;-2/p+2 |
| InChIKey | HIRDSHLCDBMFJF-UHFFFAOYSA-P |
| XLogP | -5.22 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.07 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxidoboranylformonitrile;bis(trimethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxidoboranylformonitrile;bis(trimethylazanium)?
The IUPAC name of dioxidoboranylformonitrile;bis(trimethylazanium) (CID 139949980) is dioxidoboranylformonitrile;bis(trimethylazanium).
What is the SMILES notation for dioxidoboranylformonitrile;bis(trimethylazanium)?
The canonical SMILES for dioxidoboranylformonitrile;bis(trimethylazanium) is C[NH+](C)C.C[NH+](C)C.N#CB([O-])[O-].
What is the InChIKey of dioxidoboranylformonitrile;bis(trimethylazanium)?
The InChIKey is HIRDSHLCDBMFJF-UHFFFAOYSA-P. The full InChI is InChI=1S/2C3H9N.CBNO2/c2*1-4(2)3;3-1-2(4)5/h2*1-3H3;/q;;-2/p+2.
What are the key properties of dioxidoboranylformonitrile;bis(trimethylazanium)?
dioxidoboranylformonitrile;bis(trimethylazanium) has a molecular weight of 189.07 g/mol, XLogP of -5.22, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxidoboranylformonitrile;bis(trimethylazanium) is sourced from PubChem (CID 139949980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).