C20H21ClN4O3 — CID 139949983
3-[4-(4-chloro-3-hydroxyphenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-N-methoxy-N,2-dimethylpropanamide (PubChem CID 139949983) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 3-[4-(4-chloro-3-hydroxyphenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-N-methoxy-N,2-dimethylpropanamide.
| Compound Name | 3-[4-(4-chloro-3-hydroxyphenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-N-methoxy-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 139949983 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 3-[4-(4-chloro-3-hydroxyphenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-N-methoxy-N,2-dimethylpropanamide |
| SMILES | CON(C)C(=O)C(C)Cc1nc(-c2ccc(Cl)c(O)c2)c(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C20H21ClN4O3/c1-12(20(27)25(2)28-3)10-17-23-18(13-6-8-22-9-7-13)19(24-17)14-4-5-15(21)16(26)11-14/h4-9,11-12,26H,10H2,1-3H3,(H,23,24) |
| InChIKey | UFQFGMDETJNZCS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|