C15H12N2 — CID 139950886
7,11-dihydro-6H-indeno[1,2-c][1,7]naphthyridine (PubChem CID 139950886) has the molecular formula C15H12N2 and a molecular weight of 220.28 g/mol. Its IUPAC name is 7,11-dihydro-6H-indeno[1,2-c][1,7]naphthyridine.
| Compound Name | 7,11-dihydro-6H-indeno[1,2-c][1,7]naphthyridine |
|---|---|
| PubChem CID | 139950886 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 7,11-dihydro-6H-indeno[1,2-c][1,7]naphthyridine |
| SMILES | C1=CCC2=C3CN=c4cnccc4=C3CC2=C1 |
| InChI | InChI=1S/C15H12N2/c1-2-4-11-10(3-1)7-13-12-5-6-16-9-15(12)17-8-14(11)13/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | KYQZZNPSRCKCNT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |