C22H15Br2NO2 — CID 139950916
3-(4-acridin-1-yl-3,5-dibromophenyl)propanoic acid (PubChem CID 139950916) has the molecular formula C22H15Br2NO2 and a molecular weight of 485.18 g/mol. Its IUPAC name is 3-(4-acridin-1-yl-3,5-dibromophenyl)propanoic acid.
| Compound Name | 3-(4-acridin-1-yl-3,5-dibromophenyl)propanoic acid |
|---|---|
| PubChem CID | 139950916 |
| Molecular Formula | C22H15Br2NO2 |
| Molecular Weight | 485.18 g/mol |
| Exact Mass | 482.95 |
| IUPAC Name | 3-(4-acridin-1-yl-3,5-dibromophenyl)propanoic acid |
| SMILES | O=C(O)CCc1cc(Br)c(-c2cccc3nc4ccccc4cc23)c(Br)c1 |
| InChI | InChI=1S/C22H15Br2NO2/c23-17-10-13(8-9-21(26)27)11-18(24)22(17)15-5-3-7-20-16(15)12-14-4-1-2-6-19(14)25-20/h1-7,10-12H,8-9H2,(H,26,27) |
| InChIKey | QPGWCIJKILHCDQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.18 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|