About 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol
4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol (PubChem CID 139952328) has the molecular formula C30H36O3
and a molecular weight of 444.62 g/mol. Its IUPAC name is 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol.
Molecular Properties
| Compound Name | 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol |
| PubChem CID | 139952328 |
| Molecular Formula | C30H36O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol |
| SMILES | CCC(C)CC(c1ccc(O)cc1)C1CCC(c2ccc(O)cc2)(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C30H36O3/c1-3-21(2)20-29(22-4-10-26(31)11-5-22)23-16-18-30(19-17-23,24-6-12-27(32)13-7-24)25-8-14-28(33)15-9-25/h4-15,21,23,29,31-33H,3,16-20H2,1-2H3 |
| InChIKey | FKOIBDICSSVRHO-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol?
The IUPAC name of 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol (CID 139952328) is 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol.
What is the SMILES notation for 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol?
The canonical SMILES for 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol is CCC(C)CC(c1ccc(O)cc1)C1CCC(c2ccc(O)cc2)(c2ccc(O)cc2)CC1.
What is the InChIKey of 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol?
The InChIKey is FKOIBDICSSVRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H36O3/c1-3-21(2)20-29(22-4-10-26(31)11-5-22)23-16-18-30(19-17-23,24-6-12-27(32)13-7-24)25-8-14-28(33)15-9-25/h4-15,21,23,29,31-33H,3,16-20H2,1-2H3.
What are the key properties of 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol?
4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol has a molecular weight of 444.62 g/mol, XLogP of 7.50, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4,4-bis(4-hydroxyphenyl)cyclohexyl]-3-methylpentyl]phenol is sourced from PubChem (CID 139952328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).