C31H36O3 — CID 139952370
4-[1-(4-hydroxyphenyl)-4-[1-(4-hydroxyphenyl)-3-methylcyclohexyl]cyclohexyl]phenol (PubChem CID 139952370) has the molecular formula C31H36O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)-4-[1-(4-hydroxyphenyl)-3-methylcyclohexyl]cyclohexyl]phenol.
| Compound Name | 4-[1-(4-hydroxyphenyl)-4-[1-(4-hydroxyphenyl)-3-methylcyclohexyl]cyclohexyl]phenol |
|---|---|
| PubChem CID | 139952370 |
| Molecular Formula | C31H36O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-4-[1-(4-hydroxyphenyl)-3-methylcyclohexyl]cyclohexyl]phenol |
| SMILES | CC1CCCC(c2ccc(O)cc2)(C2CCC(c3ccc(O)cc3)(c3ccc(O)cc3)CC2)C1 |
| InChI | InChI=1S/C31H36O3/c1-22-3-2-18-31(21-22,25-8-14-29(34)15-9-25)26-16-19-30(20-17-26,23-4-10-27(32)11-5-23)24-6-12-28(33)13-7-24/h4-15,22,26,32-34H,2-3,16-21H2,1H3 |
| InChIKey | XOTGCZGHEYAFNN-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |