C32H58N2O3 — CID 139952767
3-N,9-N-diethyl-3-N,9-N-dioctyl-2,6,10-trioxabicyclo[9.3.1]pentadeca-1(15),11,13-triene-3,9-diamine (PubChem CID 139952767) has the molecular formula C32H58N2O3 and a molecular weight of 518.83 g/mol. Its IUPAC name is 3-N,9-N-diethyl-3-N,9-N-dioctyl-2,6,10-trioxabicyclo[9.3.1]pentadeca-1(15),11,13-triene-3,9-diamine.
| Compound Name | 3-N,9-N-diethyl-3-N,9-N-dioctyl-2,6,10-trioxabicyclo[9.3.1]pentadeca-1(15),11,13-triene-3,9-diamine |
|---|---|
| PubChem CID | 139952767 |
| Molecular Formula | C32H58N2O3 |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.44 |
| IUPAC Name | 3-N,9-N-diethyl-3-N,9-N-dioctyl-2,6,10-trioxabicyclo[9.3.1]pentadeca-1(15),11,13-triene-3,9-diamine |
| SMILES | CCCCCCCCN(CC)C1CCOCCC(N(CC)CCCCCCCC)Oc2cccc(c2)O1 |
| InChI | InChI=1S/C32H58N2O3/c1-5-9-11-13-15-17-24-33(7-3)31-22-26-35-27-23-32(37-30-21-19-20-29(28-30)36-31)34(8-4)25-18-16-14-12-10-6-2/h19-21,28,31-32H,5-18,22-27H2,1-4H3 |
| InChIKey | VQGWYDCPUUOCSA-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|