C28H50N2O3 — CID 139952781
3-N,9-N-diethyl-3-N,9-N-dihexyl-2,6,10-trioxabicyclo[9.2.2]pentadeca-1(13),11,14-triene-3,9-diamine (PubChem CID 139952781) has the molecular formula C28H50N2O3 and a molecular weight of 462.72 g/mol. Its IUPAC name is 3-N,9-N-diethyl-3-N,9-N-dihexyl-2,6,10-trioxabicyclo[9.2.2]pentadeca-1(13),11,14-triene-3,9-diamine.
| Compound Name | 3-N,9-N-diethyl-3-N,9-N-dihexyl-2,6,10-trioxabicyclo[9.2.2]pentadeca-1(13),11,14-triene-3,9-diamine |
|---|---|
| PubChem CID | 139952781 |
| Molecular Formula | C28H50N2O3 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.38 |
| IUPAC Name | 3-N,9-N-diethyl-3-N,9-N-dihexyl-2,6,10-trioxabicyclo[9.2.2]pentadeca-1(13),11,14-triene-3,9-diamine |
| SMILES | CCCCCCN(CC)C1CCOCCC(N(CC)CCCCCC)Oc2ccc(cc2)O1 |
| InChI | InChI=1S/C28H50N2O3/c1-5-9-11-13-21-29(7-3)27-19-23-31-24-20-28(30(8-4)22-14-12-10-6-2)33-26-17-15-25(32-27)16-18-26/h15-18,27-28H,5-14,19-24H2,1-4H3 |
| InChIKey | CEUFUFHWEHONCK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|