C16H26N2O3 — CID 139953620
3-N,7-N-diethyl-3-N,7-N-dimethyl-2,5,8-trioxabicyclo[7.3.1]trideca-1(13),9,11-triene-3,7-diamine (PubChem CID 139953620) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-N,7-N-diethyl-3-N,7-N-dimethyl-2,5,8-trioxabicyclo[7.3.1]trideca-1(13),9,11-triene-3,7-diamine.
| Compound Name | 3-N,7-N-diethyl-3-N,7-N-dimethyl-2,5,8-trioxabicyclo[7.3.1]trideca-1(13),9,11-triene-3,7-diamine |
|---|---|
| PubChem CID | 139953620 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 3-N,7-N-diethyl-3-N,7-N-dimethyl-2,5,8-trioxabicyclo[7.3.1]trideca-1(13),9,11-triene-3,7-diamine |
| SMILES | CCN(C)C1COCC(N(C)CC)Oc2cccc(c2)O1 |
| InChI | InChI=1S/C16H26N2O3/c1-5-17(3)15-11-19-12-16(18(4)6-2)21-14-9-7-8-13(10-14)20-15/h7-10,15-16H,5-6,11-12H2,1-4H3 |
| InChIKey | ZHQMQIKZMKGVCH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |