C38H68N2O4 — CID 139956404
bis[3-(dihexylamino)propyl] benzene-1,4-dicarboxylate (PubChem CID 139956404) has the molecular formula C38H68N2O4 and a molecular weight of 616.97 g/mol. Its IUPAC name is bis[3-(dihexylamino)propyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[3-(dihexylamino)propyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139956404 |
| Molecular Formula | C38H68N2O4 |
| Molecular Weight | 616.97 g/mol |
| Exact Mass | 616.52 |
| IUPAC Name | bis[3-(dihexylamino)propyl] benzene-1,4-dicarboxylate |
| SMILES | CCCCCCN(CCCCCC)CCCOC(=O)c1ccc(C(=O)OCCCN(CCCCCC)CCCCCC)cc1 |
| InChI | InChI=1S/C38H68N2O4/c1-5-9-13-17-27-39(28-18-14-10-6-2)31-21-33-43-37(41)35-23-25-36(26-24-35)38(42)44-34-22-32-40(29-19-15-11-7-3)30-20-16-12-8-4/h23-26H,5-22,27-34H2,1-4H3 |
| InChIKey | RFMXIVIOQYEBAM-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.97 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|