C22H46O4 — CID 139956856
2,2,4-trimethyl-4-[2-methyl-3-(2,4,4-trimethylpentan-2-ylperoxy)pentan-3-yl]peroxypentane (PubChem CID 139956856) has the molecular formula C22H46O4 and a molecular weight of 374.61 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-[2-methyl-3-(2,4,4-trimethylpentan-2-ylperoxy)pentan-3-yl]peroxypentane.
| Compound Name | 2,2,4-trimethyl-4-[2-methyl-3-(2,4,4-trimethylpentan-2-ylperoxy)pentan-3-yl]peroxypentane |
|---|---|
| PubChem CID | 139956856 |
| Molecular Formula | C22H46O4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | 2,2,4-trimethyl-4-[2-methyl-3-(2,4,4-trimethylpentan-2-ylperoxy)pentan-3-yl]peroxypentane |
| SMILES | CCC(OOC(C)(C)CC(C)(C)C)(OOC(C)(C)CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C22H46O4/c1-14-22(17(2)3,25-23-20(10,11)15-18(4,5)6)26-24-21(12,13)16-19(7,8)9/h17H,14-16H2,1-13H3 |
| InChIKey | NFBMYNFCQFNXRS-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|