About 2-hexoxypropanoyl fluoride
2-hexoxypropanoyl fluoride (PubChem CID 139957483) has the molecular formula C9H17FO2
and a molecular weight of 176.23 g/mol. Its IUPAC name is 2-hexoxypropanoyl fluoride.
Molecular Properties
| Compound Name | 2-hexoxypropanoyl fluoride |
| PubChem CID | 139957483 |
| Molecular Formula | C9H17FO2 |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-hexoxypropanoyl fluoride |
| SMILES | CCCCCCOC(C)C(=O)F |
| InChI | InChI=1S/C9H17FO2/c1-3-4-5-6-7-12-8(2)9(10)11/h8H,3-7H2,1-2H3 |
| InChIKey | QYULROLSLACQDK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexoxypropanoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexoxypropanoyl fluoride?
The IUPAC name of 2-hexoxypropanoyl fluoride (CID 139957483) is 2-hexoxypropanoyl fluoride.
What is the SMILES notation for 2-hexoxypropanoyl fluoride?
The canonical SMILES for 2-hexoxypropanoyl fluoride is CCCCCCOC(C)C(=O)F.
What is the InChIKey of 2-hexoxypropanoyl fluoride?
The InChIKey is QYULROLSLACQDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FO2/c1-3-4-5-6-7-12-8(2)9(10)11/h8H,3-7H2,1-2H3.
What are the key properties of 2-hexoxypropanoyl fluoride?
2-hexoxypropanoyl fluoride has a molecular weight of 176.23 g/mol, XLogP of 2.47, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexoxypropanoyl fluoride is sourced from PubChem (CID 139957483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).