C21H34O — CID 139957728
1,3-bis(2,6,6-trimethylcyclohex-3-en-1-yl)propan-2-one (PubChem CID 139957728) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is 1,3-bis(2,6,6-trimethylcyclohex-3-en-1-yl)propan-2-one.
| Compound Name | 1,3-bis(2,6,6-trimethylcyclohex-3-en-1-yl)propan-2-one |
|---|---|
| PubChem CID | 139957728 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 1,3-bis(2,6,6-trimethylcyclohex-3-en-1-yl)propan-2-one |
| SMILES | CC1C=CCC(C)(C)C1CC(=O)CC1C(C)C=CCC1(C)C |
| InChI | InChI=1S/C21H34O/c1-15-9-7-11-20(3,4)18(15)13-17(22)14-19-16(2)10-8-12-21(19,5)6/h7-10,15-16,18-19H,11-14H2,1-6H3 |
| InChIKey | MPVJLCYQZWFEAL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|