C26H30F6N4O7S — CID 139958065
2-[2-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazin-1-yl]ethoxy]-N-methylsulfonylacetamide (PubChem CID 139958065) has the molecular formula C26H30F6N4O7S and a molecular weight of 656.60 g/mol. Its IUPAC name is 2-[2-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazin-1-yl]ethoxy]-N-methylsulfonylacetamide.
| Compound Name | 2-[2-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazin-1-yl]ethoxy]-N-methylsulfonylacetamide |
|---|---|
| PubChem CID | 139958065 |
| Molecular Formula | C26H30F6N4O7S |
| Molecular Weight | 656.60 g/mol |
| Exact Mass | 656.17 |
| IUPAC Name | 2-[2-[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazin-1-yl]ethoxy]-N-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)NC(=O)COCCN1CCN(C(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H30F6N4O7S/c1-44(40,41)33-24(37)17-42-11-10-34-6-8-35(9-7-34)23(21-4-2-3-5-22(21)36(38)39)16-43-15-18-12-19(25(27,28)29)14-20(13-18)26(30,31)32/h2-5,12-14,23H,6-11,15-17H2,1H3,(H,33,37) |
| InChIKey | JEBDLWIKIPFPOY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|