C12H12F6O3 — CID 139958138
3-[(2-ethyl-4,4,4-trifluoro-3-oxobut-1-enoxy)methylidene]-1,1,1-trifluoropentan-2-one (PubChem CID 139958138) has the molecular formula C12H12F6O3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 3-[(2-ethyl-4,4,4-trifluoro-3-oxobut-1-enoxy)methylidene]-1,1,1-trifluoropentan-2-one.
| Compound Name | 3-[(2-ethyl-4,4,4-trifluoro-3-oxobut-1-enoxy)methylidene]-1,1,1-trifluoropentan-2-one |
|---|---|
| PubChem CID | 139958138 |
| Molecular Formula | C12H12F6O3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-[(2-ethyl-4,4,4-trifluoro-3-oxobut-1-enoxy)methylidene]-1,1,1-trifluoropentan-2-one |
| SMILES | CCC(=COC=C(CC)C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H12F6O3/c1-3-7(9(19)11(13,14)15)5-21-6-8(4-2)10(20)12(16,17)18/h5-6H,3-4H2,1-2H3 |
| InChIKey | DFYPLGSWHDXYCS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|