C10H17NO2S — CID 139959322
1-(4-methylsulfanylbutyl)piperidine-2,6-dione (PubChem CID 139959322) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-(4-methylsulfanylbutyl)piperidine-2,6-dione.
| Compound Name | 1-(4-methylsulfanylbutyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 139959322 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-(4-methylsulfanylbutyl)piperidine-2,6-dione |
| SMILES | CSCCCCN1C(=O)CCCC1=O |
| InChI | InChI=1S/C10H17NO2S/c1-14-8-3-2-7-11-9(12)5-4-6-10(11)13/h2-8H2,1H3 |
| InChIKey | KFDCHBKTBXVCOL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|