C24H26INO4 — CID 139959686
methyl 2-iodo-4-(6-methoxy-4,4,8,8-tetramethyl-3,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzoate (PubChem CID 139959686) has the molecular formula C24H26INO4 and a molecular weight of 519.38 g/mol. Its IUPAC name is methyl 2-iodo-4-(6-methoxy-4,4,8,8-tetramethyl-3,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzoate.
| Compound Name | methyl 2-iodo-4-(6-methoxy-4,4,8,8-tetramethyl-3,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzoate |
|---|---|
| PubChem CID | 139959686 |
| Molecular Formula | C24H26INO4 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | methyl 2-iodo-4-(6-methoxy-4,4,8,8-tetramethyl-3,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2=NCC(C)(C)c3cc(OC)c4c(c32)CC(C)(C)O4)cc1I |
| InChI | InChI=1S/C24H26INO4/c1-23(2)12-26-20(13-7-8-14(17(25)9-13)22(27)29-6)19-15-11-24(3,4)30-21(15)18(28-5)10-16(19)23/h7-10H,11-12H2,1-6H3 |
| InChIKey | OSRAWSBHVQKBMC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|