C10H6Cl2N4O6S — CID 139959851
5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-hydroxy-3-sulfobenzoic acid (PubChem CID 139959851) has the molecular formula C10H6Cl2N4O6S and a molecular weight of 381.15 g/mol. Its IUPAC name is 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-hydroxy-3-sulfobenzoic acid.
| Compound Name | 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-hydroxy-3-sulfobenzoic acid |
|---|---|
| PubChem CID | 139959851 |
| Molecular Formula | C10H6Cl2N4O6S |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-hydroxy-3-sulfobenzoic acid |
| SMILES | O=C(O)c1cc(Nc2nc(Cl)nc(Cl)n2)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C10H6Cl2N4O6S/c11-8-14-9(12)16-10(15-8)13-3-1-4(7(18)19)6(17)5(2-3)23(20,21)22/h1-2,17H,(H,18,19)(H,20,21,22)(H,13,14,15,16) |
| InChIKey | DWTOQIFJHHBYMV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 162.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|