C5F8N2S — CID 139959854
5-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-thiadiazole (PubChem CID 139959854) has the molecular formula C5F8N2S and a molecular weight of 272.12 g/mol. Its IUPAC name is 5-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-thiadiazole.
| Compound Name | 5-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 139959854 |
| Molecular Formula | C5F8N2S |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 5-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-thiadiazole |
| SMILES | Fc1nc(C(F)(F)C(F)(F)C(F)(F)F)ns1 |
| InChI | InChI=1S/C5F8N2S/c6-2-14-1(15-16-2)3(7,8)4(9,10)5(11,12)13 |
| InChIKey | JKUDPAUENXFNJM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|