C19H30FN5 — CID 139960190
7-[(3R,4R)-3-(2-aminopropan-2-yl)-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-8-methyl-2,4-dihydroquinazolin-3-amine (PubChem CID 139960190) has the molecular formula C19H30FN5 and a molecular weight of 347.48 g/mol. Its IUPAC name is 7-[(3R,4R)-3-(2-aminopropan-2-yl)-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-8-methyl-2,4-dihydroquinazolin-3-amine.
| Compound Name | 7-[(3R,4R)-3-(2-aminopropan-2-yl)-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-8-methyl-2,4-dihydroquinazolin-3-amine |
|---|---|
| PubChem CID | 139960190 |
| Molecular Formula | C19H30FN5 |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 7-[(3R,4R)-3-(2-aminopropan-2-yl)-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-8-methyl-2,4-dihydroquinazolin-3-amine |
| SMILES | Cc1c(N2C[C@H](F)[C@@H](C(C)(C)N)C2)ccc2c1N(C1CC1)CN(N)C2 |
| InChI | InChI=1S/C19H30FN5/c1-12-17(23-9-15(16(20)10-23)19(2,3)21)7-4-13-8-24(22)11-25(18(12)13)14-5-6-14/h4,7,14-16H,5-6,8-11,21-22H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | RQUXVHUTFLLUCN-HOTGVXAUSA-N |
| XLogP | 2.12 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|