C9H12OS — CID 139961983
3,4-diethylthiophene-2-carbaldehyde (PubChem CID 139961983) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is 3,4-diethylthiophene-2-carbaldehyde.
| Compound Name | 3,4-diethylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139961983 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 3,4-diethylthiophene-2-carbaldehyde |
| SMILES | CCc1csc(C=O)c1CC |
| InChI | InChI=1S/C9H12OS/c1-3-7-6-11-9(5-10)8(7)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | DHWBFAKUTRBGQS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|