About 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol
1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol (PubChem CID 139962055) has the molecular formula C7H12N2S2
and a molecular weight of 188.32 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol.
Molecular Properties
| Compound Name | 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol |
| PubChem CID | 139962055 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol |
| SMILES | SC1CN(C2=NCCSC2)C1 |
| InChI | InChI=1S/C7H12N2S2/c10-6-3-9(4-6)7-5-11-2-1-8-7/h6,10H,1-5H2 |
| InChIKey | HCUSTVKHMDYPOW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol?
The IUPAC name of 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol (CID 139962055) is 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol.
What is the SMILES notation for 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol?
The canonical SMILES for 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol is SC1CN(C2=NCCSC2)C1.
What is the InChIKey of 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol?
The InChIKey is HCUSTVKHMDYPOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2S2/c10-6-3-9(4-6)7-5-11-2-1-8-7/h6,10H,1-5H2.
What are the key properties of 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol?
1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol has a molecular weight of 188.32 g/mol, XLogP of 0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dihydro-2H-1,4-thiazin-5-yl)azetidine-3-thiol is sourced from PubChem (CID 139962055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).