C18H16Cl2 — CID 139963495
9,10-dichloro-1,2,3,4-tetramethylanthracene (PubChem CID 139963495) has the molecular formula C18H16Cl2 and a molecular weight of 303.23 g/mol. Its IUPAC name is 9,10-dichloro-1,2,3,4-tetramethylanthracene.
| Compound Name | 9,10-dichloro-1,2,3,4-tetramethylanthracene |
|---|---|
| PubChem CID | 139963495 |
| Molecular Formula | C18H16Cl2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 9,10-dichloro-1,2,3,4-tetramethylanthracene |
| SMILES | Cc1c(C)c(C)c2c(Cl)c3ccccc3c(Cl)c2c1C |
| InChI | InChI=1S/C18H16Cl2/c1-9-10(2)12(4)16-15(11(9)3)17(19)13-7-5-6-8-14(13)18(16)20/h5-8H,1-4H3 |
| InChIKey | OVVJFUVSEPQPLY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|