C23H28O2 — CID 139965056
1-[2-(3-tert-butyl-2,5-dimethoxyphenyl)ethyl]-1H-indene (PubChem CID 139965056) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[2-(3-tert-butyl-2,5-dimethoxyphenyl)ethyl]-1H-indene.
| Compound Name | 1-[2-(3-tert-butyl-2,5-dimethoxyphenyl)ethyl]-1H-indene |
|---|---|
| PubChem CID | 139965056 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1-[2-(3-tert-butyl-2,5-dimethoxyphenyl)ethyl]-1H-indene |
| SMILES | COc1cc(CCC2C=Cc3ccccc32)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H28O2/c1-23(2,3)21-15-19(24-4)14-18(22(21)25-5)13-12-17-11-10-16-8-6-7-9-20(16)17/h6-11,14-15,17H,12-13H2,1-5H3 |
| InChIKey | DQTIIAKUKXEDHT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |