C14H24O4 — CID 139966366
(2-methyl-2-pentyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate (PubChem CID 139966366) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2-methyl-2-pentyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (2-methyl-2-pentyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139966366 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (2-methyl-2-pentyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1COC(C)(CCCCC)O1 |
| InChI | InChI=1S/C14H24O4/c1-5-6-7-8-14(4)17-10-12(18-14)9-16-13(15)11(2)3/h12H,2,5-10H2,1,3-4H3 |
| InChIKey | BCINPVMIZMHINU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|