C24H33NO5S2Si — CID 139966501
(4R,5S)-2-[tert-butyl(dimethyl)silyl]-4-ethenyl-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylic acid (PubChem CID 139966501) has the molecular formula C24H33NO5S2Si and a molecular weight of 507.75 g/mol. Its IUPAC name is (4R,5S)-2-[tert-butyl(dimethyl)silyl]-4-ethenyl-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylic acid.
| Compound Name | (4R,5S)-2-[tert-butyl(dimethyl)silyl]-4-ethenyl-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylic acid |
|---|---|
| PubChem CID | 139966501 |
| Molecular Formula | C24H33NO5S2Si |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (4R,5S)-2-[tert-butyl(dimethyl)silyl]-4-ethenyl-6-(4-methoxyphenyl)sulfonyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-5-carboxylic acid |
| SMILES | C=C[C@@H]1c2cc([Si](C)(C)C(C)(C)C)sc2CCN(S(=O)(=O)c2ccc(OC)cc2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C24H33NO5S2Si/c1-8-18-19-15-21(33(6,7)24(2,3)4)31-20(19)13-14-25(22(18)23(26)27)32(28,29)17-11-9-16(30-5)10-12-17/h8-12,15,18,22H,1,13-14H2,2-7H3,(H,26,27)/t18-,22+/m1/s1 |
| InChIKey | MCMCXGJKQFEXTR-GCJKJVERSA-N |
| XLogP | 4.44 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|