4-acetyl-3-phenylbenzoic acid

C15H12O3 — CID 139966982

IUPAC4-acetyl-3-phenylbenzoic acid
SMILESCC(=O)c1ccc(C(=O)O)cc1-c1ccccc1
InChIInChI=1S/C15H12O3/c1-10(16)13-8-7-12(15(17)18)9-14(13)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,18)
InChIKeyVMODLYJQUDCBDX-UHFFFAOYSA-N
MW240.26 g/mol
LogP3.25
Rot. Bonds3

About 4-acetyl-3-phenylbenzoic acid

4-acetyl-3-phenylbenzoic acid (PubChem CID 139966982) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-acetyl-3-phenylbenzoic acid.

Molecular Properties

Compound Name4-acetyl-3-phenylbenzoic acid
PubChem CID139966982
Molecular FormulaC15H12O3
Molecular Weight240.26 g/mol
Exact Mass240.08
IUPAC Name4-acetyl-3-phenylbenzoic acid
SMILESCC(=O)c1ccc(C(=O)O)cc1-c1ccccc1
InChIInChI=1S/C15H12O3/c1-10(16)13-8-7-12(15(17)18)9-14(13)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,18)
InChIKeyVMODLYJQUDCBDX-UHFFFAOYSA-N
XLogP3.25
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 53.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-acetyl-3-phenylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-acetyl-3-phenylbenzoic acid?
The IUPAC name of 4-acetyl-3-phenylbenzoic acid (CID 139966982) is 4-acetyl-3-phenylbenzoic acid.
What is the SMILES notation for 4-acetyl-3-phenylbenzoic acid?
The canonical SMILES for 4-acetyl-3-phenylbenzoic acid is CC(=O)c1ccc(C(=O)O)cc1-c1ccccc1.
What is the InChIKey of 4-acetyl-3-phenylbenzoic acid?
The InChIKey is VMODLYJQUDCBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3/c1-10(16)13-8-7-12(15(17)18)9-14(13)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,18).
What are the key properties of 4-acetyl-3-phenylbenzoic acid?
4-acetyl-3-phenylbenzoic acid has a molecular weight of 240.26 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-3-phenylbenzoic acid is sourced from PubChem (CID 139966982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).