About 4-acetyl-3-phenylbenzoic acid
4-acetyl-3-phenylbenzoic acid (PubChem CID 139966982) has the molecular formula C15H12O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-acetyl-3-phenylbenzoic acid.
Molecular Properties
| Compound Name | 4-acetyl-3-phenylbenzoic acid |
| PubChem CID | 139966982 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4-acetyl-3-phenylbenzoic acid |
| SMILES | CC(=O)c1ccc(C(=O)O)cc1-c1ccccc1 |
| InChI | InChI=1S/C15H12O3/c1-10(16)13-8-7-12(15(17)18)9-14(13)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,18) |
| InChIKey | VMODLYJQUDCBDX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-acetyl-3-phenylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-3-phenylbenzoic acid?
The IUPAC name of 4-acetyl-3-phenylbenzoic acid (CID 139966982) is 4-acetyl-3-phenylbenzoic acid.
What is the SMILES notation for 4-acetyl-3-phenylbenzoic acid?
The canonical SMILES for 4-acetyl-3-phenylbenzoic acid is CC(=O)c1ccc(C(=O)O)cc1-c1ccccc1.
What is the InChIKey of 4-acetyl-3-phenylbenzoic acid?
The InChIKey is VMODLYJQUDCBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3/c1-10(16)13-8-7-12(15(17)18)9-14(13)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,18).
What are the key properties of 4-acetyl-3-phenylbenzoic acid?
4-acetyl-3-phenylbenzoic acid has a molecular weight of 240.26 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-3-phenylbenzoic acid is sourced from PubChem (CID 139966982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).