C16H17F4N3O2S — CID 139967083
4-[5-cyclohexyl-3-(trifluoromethyl)pyrazol-1-yl]-2-fluorobenzenesulfonamide (PubChem CID 139967083) has the molecular formula C16H17F4N3O2S and a molecular weight of 391.39 g/mol. Its IUPAC name is 4-[5-cyclohexyl-3-(trifluoromethyl)pyrazol-1-yl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-[5-cyclohexyl-3-(trifluoromethyl)pyrazol-1-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 139967083 |
| Molecular Formula | C16H17F4N3O2S |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-[5-cyclohexyl-3-(trifluoromethyl)pyrazol-1-yl]-2-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)cc2C2CCCCC2)cc1F |
| InChI | InChI=1S/C16H17F4N3O2S/c17-12-8-11(6-7-14(12)26(21,24)25)23-13(10-4-2-1-3-5-10)9-15(22-23)16(18,19)20/h6-10H,1-5H2,(H2,21,24,25) |
| InChIKey | ZXZIRTIVPOEZEU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |