C19H20BrN3O2 — CID 139967714
2-[(2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-7-yl)methyl]isoindole-1,3-dione bromide (PubChem CID 139967714) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 2-[(2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-7-yl)methyl]isoindole-1,3-dione bromide.
| Compound Name | 2-[(2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-7-yl)methyl]isoindole-1,3-dione bromide |
|---|---|
| PubChem CID | 139967714 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[(2,3,3-trimethyl-1,2-dihydropyrrolo[2,3-b]pyridin-7-ium-7-yl)methyl]isoindole-1,3-dione bromide |
| SMILES | CC1Nc2c(ccc[n+]2CN2C(=O)c3ccccc3C2=O)C1(C)C.[Br-] |
| InChI | InChI=1S/C19H19N3O2.BrH/c1-12-19(2,3)15-9-6-10-21(16(15)20-12)11-22-17(23)13-7-4-5-8-14(13)18(22)24;/h4-10,12H,11H2,1-3H3;1H |
| InChIKey | IJTRZDFXJVXSCQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|