About 4-octylspiro[4.5]decane
4-octylspiro[4.5]decane (PubChem CID 139968258) has the molecular formula C18H34
and a molecular weight of 250.47 g/mol. Its IUPAC name is 4-octylspiro[4.5]decane.
Molecular Properties
| Compound Name | 4-octylspiro[4.5]decane |
| PubChem CID | 139968258 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 4-octylspiro[4.5]decane |
| SMILES | CCCCCCCCC1CCCC12CCCCC2 |
| InChI | InChI=1S/C18H34/c1-2-3-4-5-6-8-12-17-13-11-16-18(17)14-9-7-10-15-18/h17H,2-16H2,1H3 |
| InChIKey | RQCGQKUTVVDDCE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octylspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octylspiro[4.5]decane?
The IUPAC name of 4-octylspiro[4.5]decane (CID 139968258) is 4-octylspiro[4.5]decane.
What is the SMILES notation for 4-octylspiro[4.5]decane?
The canonical SMILES for 4-octylspiro[4.5]decane is CCCCCCCCC1CCCC12CCCCC2.
What is the InChIKey of 4-octylspiro[4.5]decane?
The InChIKey is RQCGQKUTVVDDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34/c1-2-3-4-5-6-8-12-17-13-11-16-18(17)14-9-7-10-15-18/h17H,2-16H2,1H3.
What are the key properties of 4-octylspiro[4.5]decane?
4-octylspiro[4.5]decane has a molecular weight of 250.47 g/mol, XLogP of 6.49, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octylspiro[4.5]decane is sourced from PubChem (CID 139968258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).