C23H40O3Si — CID 139968516
tert-butyl-[[(1Z)-1-[4-(methoxymethoxy)butan-2-ylidene]-7a-methyl-3,5-dihydro-2H-inden-4-yl]methoxy]-dimethylsilane (PubChem CID 139968516) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is tert-butyl-[[(1Z)-1-[4-(methoxymethoxy)butan-2-ylidene]-7a-methyl-3,5-dihydro-2H-inden-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1Z)-1-[4-(methoxymethoxy)butan-2-ylidene]-7a-methyl-3,5-dihydro-2H-inden-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 139968516 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | tert-butyl-[[(1Z)-1-[4-(methoxymethoxy)butan-2-ylidene]-7a-methyl-3,5-dihydro-2H-inden-4-yl]methoxy]-dimethylsilane |
| SMILES | COCOCC/C(C)=C1/CCC2=C(CO[Si](C)(C)C(C)(C)C)CC=CC21C |
| InChI | InChI=1S/C23H40O3Si/c1-18(13-15-25-17-24-6)20-11-12-21-19(10-9-14-23(20,21)5)16-26-27(7,8)22(2,3)4/h9,14H,10-13,15-17H2,1-8H3/b20-18- |
| InChIKey | QPCHJBBBYQPAHK-ZZEZOPTASA-N |
| XLogP | 6.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|